About (2,6-ditert-butylphenyl) diphenyl phosphite
(2,6-ditert-butylphenyl) diphenyl phosphite (PubChem CID 86014872) has the molecular formula C26H31O3P
and a molecular weight of 422.51 g/mol. Its IUPAC name is (2,6-ditert-butylphenyl) diphenyl phosphite.
Molecular Properties
| Compound Name | (2,6-ditert-butylphenyl) diphenyl phosphite |
| PubChem CID | 86014872 |
| Molecular Formula | C26H31O3P |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (2,6-ditert-butylphenyl) diphenyl phosphite |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H31O3P/c1-25(2,3)22-18-13-19-23(26(4,5)6)24(22)29-30(27-20-14-9-7-10-15-20)28-21-16-11-8-12-17-21/h7-19H,1-6H3 |
| InChIKey | KFDJCMBQDCWWJI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,6-ditert-butylphenyl) diphenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-ditert-butylphenyl) diphenyl phosphite?
The IUPAC name of (2,6-ditert-butylphenyl) diphenyl phosphite (CID 86014872) is (2,6-ditert-butylphenyl) diphenyl phosphite.
What is the SMILES notation for (2,6-ditert-butylphenyl) diphenyl phosphite?
The canonical SMILES for (2,6-ditert-butylphenyl) diphenyl phosphite is CC(C)(C)c1cccc(C(C)(C)C)c1OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of (2,6-ditert-butylphenyl) diphenyl phosphite?
The InChIKey is KFDJCMBQDCWWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31O3P/c1-25(2,3)22-18-13-19-23(26(4,5)6)24(22)29-30(27-20-14-9-7-10-15-20)28-21-16-11-8-12-17-21/h7-19H,1-6H3.
What are the key properties of (2,6-ditert-butylphenyl) diphenyl phosphite?
(2,6-ditert-butylphenyl) diphenyl phosphite has a molecular weight of 422.51 g/mol, XLogP of 8.05, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-ditert-butylphenyl) diphenyl phosphite is sourced from PubChem (CID 86014872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).