About 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole
1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole (PubChem CID 86016149) has the molecular formula C21H26N4
and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole |
| PubChem CID | 86016149 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1c(N3CCC(N4CCCCC4)CC3)nccc12 |
| InChI | InChI=1S/C21H26N4/c1-4-12-24(13-5-1)16-9-14-25(15-10-16)21-20-18(8-11-22-21)17-6-2-3-7-19(17)23-20/h2-3,6-8,11,16,23H,1,4-5,9-10,12-15H2 |
| InChIKey | RSGIQGJUSWMZGB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole?
The IUPAC name of 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole (CID 86016149) is 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole is c1ccc2c(c1)[nH]c1c(N3CCC(N4CCCCC4)CC3)nccc12.
What is the InChIKey of 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole?
The InChIKey is RSGIQGJUSWMZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4/c1-4-12-24(13-5-1)16-9-14-25(15-10-16)21-20-18(8-11-22-21)17-6-2-3-7-19(17)23-20/h2-3,6-8,11,16,23H,1,4-5,9-10,12-15H2.
What are the key properties of 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole?
1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole has a molecular weight of 334.47 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-piperidin-1-ylpiperidin-1-yl)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 86016149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).