C6BrF11O — CID 86017168
2-bromo-1,1,1,2,4,4,5,5,6,6,6-undecafluorohexan-3-one (PubChem CID 86017168) has the molecular formula C6BrF11O and a molecular weight of 376.95 g/mol. Its IUPAC name is 2-bromo-1,1,1,2,4,4,5,5,6,6,6-undecafluorohexan-3-one.
| Compound Name | 2-bromo-1,1,1,2,4,4,5,5,6,6,6-undecafluorohexan-3-one |
|---|---|
| PubChem CID | 86017168 |
| Molecular Formula | C6BrF11O |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 2-bromo-1,1,1,2,4,4,5,5,6,6,6-undecafluorohexan-3-one |
| SMILES | O=C(C(F)(F)C(F)(F)C(F)(F)F)C(F)(Br)C(F)(F)F |
| InChI | InChI=1S/C6BrF11O/c7-2(8,5(13,14)15)1(19)3(9,10)4(11,12)6(16,17)18 |
| InChIKey | ZLCPRUNDFQPTEL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|