About bicyclo[2.2.0]hexa-1,4-diene
bicyclo[2.2.0]hexa-1,4-diene (PubChem CID 86017277) has the molecular formula C6H6
and a molecular weight of 78.11 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,4-diene.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,4-diene |
| PubChem CID | 86017277 |
| Molecular Formula | C6H6 |
| Molecular Weight | 78.11 g/mol |
| Exact Mass | 78.05 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,4-diene |
| SMILES | C1=C2CC=C2C1 |
| InChI | InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1,4H,2-3H2 |
| InChIKey | SKSKRZHVARBPHH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[2.2.0]hexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,4-diene?
The IUPAC name of bicyclo[2.2.0]hexa-1,4-diene (CID 86017277) is bicyclo[2.2.0]hexa-1,4-diene.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,4-diene?
The canonical SMILES for bicyclo[2.2.0]hexa-1,4-diene is C1=C2CC=C2C1.
What is the InChIKey of bicyclo[2.2.0]hexa-1,4-diene?
The InChIKey is SKSKRZHVARBPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1,4H,2-3H2.
What are the key properties of bicyclo[2.2.0]hexa-1,4-diene?
bicyclo[2.2.0]hexa-1,4-diene has a molecular weight of 78.11 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,4-diene is sourced from PubChem (CID 86017277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).