C20H42 — CID 86018360
2,5-dimethyl-3,3,4,4-tetra(propan-2-yl)hexane (PubChem CID 86018360) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is 2,5-dimethyl-3,3,4,4-tetra(propan-2-yl)hexane.
| Compound Name | 2,5-dimethyl-3,3,4,4-tetra(propan-2-yl)hexane |
|---|---|
| PubChem CID | 86018360 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 2,5-dimethyl-3,3,4,4-tetra(propan-2-yl)hexane |
| SMILES | CC(C)C(C(C)C)(C(C)C)C(C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H42/c1-13(2)19(14(3)4,15(5)6)20(16(7)8,17(9)10)18(11)12/h13-18H,1-12H3 |
| InChIKey | AZGPDYSOKVENSR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |