C15H14F2N2O2S — CID 86019800
N-(2,5-difluorophenyl)-1,2,3,4-tetrahydroquinoline-8-sulfonamide (PubChem CID 86019800) has the molecular formula C15H14F2N2O2S and a molecular weight of 324.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1,2,3,4-tetrahydroquinoline-8-sulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-1,2,3,4-tetrahydroquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 86019800 |
| Molecular Formula | C15H14F2N2O2S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-1,2,3,4-tetrahydroquinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1F)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C15H14F2N2O2S/c16-11-6-7-12(17)13(9-11)19-22(20,21)14-5-1-3-10-4-2-8-18-15(10)14/h1,3,5-7,9,18-19H,2,4,8H2 |
| InChIKey | QHEKWKAQIJTNJY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |