C13H26O4 — CID 86020895
1,1,5,5-tetraethoxypent-2-ene (PubChem CID 86020895) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,1,5,5-tetraethoxypent-2-ene.
| Compound Name | 1,1,5,5-tetraethoxypent-2-ene |
|---|---|
| PubChem CID | 86020895 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1,1,5,5-tetraethoxypent-2-ene |
| SMILES | CCOC(C=CCC(OCC)OCC)OCC |
| InChI | InChI=1S/C13H26O4/c1-5-14-12(15-6-2)10-9-11-13(16-7-3)17-8-4/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | HUOIUTLENIGUOB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|