About CID 86021218
CID 86021218 (PubChem CID 86021218) has the molecular formula C10H21OSi
and a molecular weight of 185.36 g/mol.
Molecular Properties
| Compound Name | CID 86021218 |
| PubChem CID | 86021218 |
| Molecular Formula | C10H21OSi |
| Molecular Weight | 185.36 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)OC(C)C=C(C)C |
| InChI | InChI=1S/C10H21OSi/c1-6-12(7-2)11-10(5)8-9(3)4/h8,10H,6-7H2,1-5H3 |
| InChIKey | FVCCXRWJYBKBGQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 86021218 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86021218?
The IUPAC name of CID 86021218 (CID 86021218) is not available.
What is the SMILES notation for CID 86021218?
The canonical SMILES for CID 86021218 is CC[Si](CC)OC(C)C=C(C)C.
What is the InChIKey of CID 86021218?
The InChIKey is FVCCXRWJYBKBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21OSi/c1-6-12(7-2)11-10(5)8-9(3)4/h8,10H,6-7H2,1-5H3.
What are the key properties of CID 86021218?
CID 86021218 has a molecular weight of 185.36 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86021218 is sourced from PubChem (CID 86021218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).