C26H46O6 — CID 86021610
1,4-ditert-butyl-2,5-bis(2,2-diethoxyethoxy)benzene (PubChem CID 86021610) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis(2,2-diethoxyethoxy)benzene.
| Compound Name | 1,4-ditert-butyl-2,5-bis(2,2-diethoxyethoxy)benzene |
|---|---|
| PubChem CID | 86021610 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis(2,2-diethoxyethoxy)benzene |
| SMILES | CCOC(COc1cc(C(C)(C)C)c(OCC(OCC)OCC)cc1C(C)(C)C)OCC |
| InChI | InChI=1S/C26H46O6/c1-11-27-23(28-12-2)17-31-21-15-20(26(8,9)10)22(16-19(21)25(5,6)7)32-18-24(29-13-3)30-14-4/h15-16,23-24H,11-14,17-18H2,1-10H3 |
| InChIKey | DFFRKRCSIFKVMI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|