About 2-phenoxyphenoxathiine
2-phenoxyphenoxathiine (PubChem CID 86023759) has the molecular formula C18H12O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-phenoxyphenoxathiine.
Molecular Properties
| Compound Name | 2-phenoxyphenoxathiine |
| PubChem CID | 86023759 |
| Molecular Formula | C18H12O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-phenoxyphenoxathiine |
| SMILES | c1ccc(Oc2ccc3c(c2)Sc2ccccc2O3)cc1 |
| InChI | InChI=1S/C18H12O2S/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)21-17-9-5-4-8-15(17)20-16/h1-12H |
| InChIKey | WCQNKEIUMPTSLM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxyphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyphenoxathiine?
The IUPAC name of 2-phenoxyphenoxathiine (CID 86023759) is 2-phenoxyphenoxathiine.
What is the SMILES notation for 2-phenoxyphenoxathiine?
The canonical SMILES for 2-phenoxyphenoxathiine is c1ccc(Oc2ccc3c(c2)Sc2ccccc2O3)cc1.
What is the InChIKey of 2-phenoxyphenoxathiine?
The InChIKey is WCQNKEIUMPTSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2S/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)21-17-9-5-4-8-15(17)20-16/h1-12H.
What are the key properties of 2-phenoxyphenoxathiine?
2-phenoxyphenoxathiine has a molecular weight of 292.36 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyphenoxathiine is sourced from PubChem (CID 86023759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).