About 4-pentyl-2-propyl-1,3-oxazole
4-pentyl-2-propyl-1,3-oxazole (PubChem CID 86025809) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-pentyl-2-propyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-pentyl-2-propyl-1,3-oxazole |
| PubChem CID | 86025809 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-pentyl-2-propyl-1,3-oxazole |
| SMILES | CCCCCc1coc(CCC)n1 |
| InChI | InChI=1S/C11H19NO/c1-3-5-6-8-10-9-13-11(12-10)7-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | CWKOCMVGFKRRFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-2-propyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-2-propyl-1,3-oxazole?
The IUPAC name of 4-pentyl-2-propyl-1,3-oxazole (CID 86025809) is 4-pentyl-2-propyl-1,3-oxazole.
What is the SMILES notation for 4-pentyl-2-propyl-1,3-oxazole?
The canonical SMILES for 4-pentyl-2-propyl-1,3-oxazole is CCCCCc1coc(CCC)n1.
What is the InChIKey of 4-pentyl-2-propyl-1,3-oxazole?
The InChIKey is CWKOCMVGFKRRFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-6-8-10-9-13-11(12-10)7-4-2/h9H,3-8H2,1-2H3.
What are the key properties of 4-pentyl-2-propyl-1,3-oxazole?
4-pentyl-2-propyl-1,3-oxazole has a molecular weight of 181.28 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-2-propyl-1,3-oxazole is sourced from PubChem (CID 86025809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).