About 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol
4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol (PubChem CID 86027596) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol.
Molecular Properties
| Compound Name | 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol |
| PubChem CID | 86027596 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol |
| SMILES | CCCCOc1c(OC)ccc2c1CC=CCC2O |
| InChI | InChI=1S/C16H22O3/c1-3-4-11-19-16-13-7-5-6-8-14(17)12(13)9-10-15(16)18-2/h5-6,9-10,14,17H,3-4,7-8,11H2,1-2H3 |
| InChIKey | BNEIEFLFVMENGU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol?
The IUPAC name of 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol (CID 86027596) is 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol.
What is the SMILES notation for 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol?
The canonical SMILES for 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol is CCCCOc1c(OC)ccc2c1CC=CCC2O.
What is the InChIKey of 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol?
The InChIKey is BNEIEFLFVMENGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-3-4-11-19-16-13-7-5-6-8-14(17)12(13)9-10-15(16)18-2/h5-6,9-10,14,17H,3-4,7-8,11H2,1-2H3.
What are the key properties of 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol?
4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol has a molecular weight of 262.35 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-3-methoxy-8,9-dihydro-5H-benzo[7]annulen-9-ol is sourced from PubChem (CID 86027596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).