About 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol
4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol (PubChem CID 860281) has the molecular formula C17H18ClN3O
and a molecular weight of 315.80 g/mol. Its IUPAC name is 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol |
| PubChem CID | 860281 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol |
| SMILES | CC(C)(C)Nc1c(-c2ccc(O)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C17H18ClN3O/c1-17(2,3)20-16-15(11-4-7-13(22)8-5-11)19-14-9-6-12(18)10-21(14)16/h4-10,20,22H,1-3H3 |
| InChIKey | WIHOVZUPQKTPJM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol?
The IUPAC name of 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol (CID 860281) is 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol.
What is the SMILES notation for 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol?
The canonical SMILES for 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol is CC(C)(C)Nc1c(-c2ccc(O)cc2)nc2ccc(Cl)cn12.
What is the InChIKey of 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol?
The InChIKey is WIHOVZUPQKTPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O/c1-17(2,3)20-16-15(11-4-7-13(22)8-5-11)19-14-9-6-12(18)10-21(14)16/h4-10,20,22H,1-3H3.
What are the key properties of 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol?
4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol has a molecular weight of 315.80 g/mol, XLogP of 4.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(tert-butylamino)-6-chloroimidazo[1,2-a]pyridin-2-yl]phenol is sourced from PubChem (CID 860281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).