C9H6Br2F4 — CID 86028337
1-bromo-4-(3-bromo-2,2,3,3-tetrafluoropropyl)benzene (PubChem CID 86028337) has the molecular formula C9H6Br2F4 and a molecular weight of 349.95 g/mol. Its IUPAC name is 1-bromo-4-(3-bromo-2,2,3,3-tetrafluoropropyl)benzene.
| Compound Name | 1-bromo-4-(3-bromo-2,2,3,3-tetrafluoropropyl)benzene |
|---|---|
| PubChem CID | 86028337 |
| Molecular Formula | C9H6Br2F4 |
| Molecular Weight | 349.95 g/mol |
| Exact Mass | 347.88 |
| IUPAC Name | 1-bromo-4-(3-bromo-2,2,3,3-tetrafluoropropyl)benzene |
| SMILES | FC(F)(Br)C(F)(F)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H6Br2F4/c10-7-3-1-6(2-4-7)5-8(12,13)9(11,14)15/h1-4H,5H2 |
| InChIKey | VVFPUIGQBKXOOB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|