C8H8O4 — CID 86030869
3-(4-methyl-2,5-dioxofuran-3-yl)propanal (PubChem CID 86030869) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxofuran-3-yl)propanal.
| Compound Name | 3-(4-methyl-2,5-dioxofuran-3-yl)propanal |
|---|---|
| PubChem CID | 86030869 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 3-(4-methyl-2,5-dioxofuran-3-yl)propanal |
| SMILES | CC1=C(CCC=O)C(=O)OC1=O |
| InChI | InChI=1S/C8H8O4/c1-5-6(3-2-4-9)8(11)12-7(5)10/h4H,2-3H2,1H3 |
| InChIKey | XNZKSUHUSKVLPB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|