About 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one
1-(benzenesulfonyl)-2,3-dihydropyridin-6-one (PubChem CID 86032167) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one |
| PubChem CID | 86032167 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11NO3S/c13-11-8-4-5-9-12(11)16(14,15)10-6-2-1-3-7-10/h1-4,6-8H,5,9H2 |
| InChIKey | XXMKASPOHUJPKD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one?
The IUPAC name of 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one (CID 86032167) is 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one is O=C1C=CCCN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one?
The InChIKey is XXMKASPOHUJPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c13-11-8-4-5-9-12(11)16(14,15)10-6-2-1-3-7-10/h1-4,6-8H,5,9H2.
What are the key properties of 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one?
1-(benzenesulfonyl)-2,3-dihydropyridin-6-one has a molecular weight of 237.28 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-2,3-dihydropyridin-6-one is sourced from PubChem (CID 86032167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).