C18H17ClN2O3S2 — CID 8603271
2-(4-chlorophenyl)sulfanylethyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 8603271) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanylethyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | 2-(4-chlorophenyl)sulfanylethyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 8603271 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanylethyl 2-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | Cc1sc2ncn(CC(=O)OCCSc3ccc(Cl)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-11-12(2)26-17-16(11)18(23)21(10-20-17)9-15(22)24-7-8-25-14-5-3-13(19)4-6-14/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | MBAWRCGJGICKEQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|