C15H17N5 — CID 86032728
N-(2-azidoethyl)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 86032728) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-(2-azidoethyl)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-(2-azidoethyl)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 86032728 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(2-azidoethyl)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | [N-]=[N+]=NCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C15H17N5/c16-20-18-10-9-17-15-11-5-1-3-7-13(11)19-14-8-4-2-6-12(14)15/h1,3,5,7H,2,4,6,8-10H2,(H,17,19) |
| InChIKey | ANJRGTMSMVLPLB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|