About 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole
3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole (PubChem CID 86036268) has the molecular formula C7H11ClN4S
and a molecular weight of 218.71 g/mol. Its IUPAC name is 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole |
| PubChem CID | 86036268 |
| Molecular Formula | C7H11ClN4S |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole |
| SMILES | CC1CN(c2nsnc2Cl)CCN1 |
| InChI | InChI=1S/C7H11ClN4S/c1-5-4-12(3-2-9-5)7-6(8)10-13-11-7/h5,9H,2-4H2,1H3 |
| InChIKey | UIABQNPVBIDRLF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole?
The IUPAC name of 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole (CID 86036268) is 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole?
The canonical SMILES for 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole is CC1CN(c2nsnc2Cl)CCN1.
What is the InChIKey of 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole?
The InChIKey is UIABQNPVBIDRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN4S/c1-5-4-12(3-2-9-5)7-6(8)10-13-11-7/h5,9H,2-4H2,1H3.
What are the key properties of 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole?
3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole has a molecular weight of 218.71 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(3-methylpiperazin-1-yl)-1,2,5-thiadiazole is sourced from PubChem (CID 86036268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).