C17H13NO3 — CID 86037624
5-methyl-3-(2-phenylphenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 86037624) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-methyl-3-(2-phenylphenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-(2-phenylphenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 86037624 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-methyl-3-(2-phenylphenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1onc(-c2ccccc2-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C17H13NO3/c1-11-15(17(19)20)16(18-21-11)14-10-6-5-9-13(14)12-7-3-2-4-8-12/h2-10H,1H3,(H,19,20) |
| InChIKey | ZAXZVGBPDKLJOV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |