C19H21N3O4S2 — CID 8603795
1-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)phenyl]-3-prop-2-enylthiourea (PubChem CID 8603795) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)phenyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)phenyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8603795 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)phenyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(NS(=O)(=O)c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-2-10-20-19(27)21-14-4-6-15(7-5-14)22-28(23,24)16-8-9-17-18(13-16)26-12-3-11-25-17/h2,4-9,13,22H,1,3,10-12H2,(H2,20,21,27) |
| InChIKey | BZFWMDVABJGEPT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|