C7H9N — CID 86038673
3-azabicyclo[3.2.1]octa-2,6-diene (PubChem CID 86038673) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 3-azabicyclo[3.2.1]octa-2,6-diene.
| Compound Name | 3-azabicyclo[3.2.1]octa-2,6-diene |
|---|---|
| PubChem CID | 86038673 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 3-azabicyclo[3.2.1]octa-2,6-diene |
| SMILES | C1=CC2CN=CC1C2 |
| InChI | InChI=1S/C7H9N/c1-2-7-3-6(1)4-8-5-7/h1-2,4,6-7H,3,5H2 |
| InChIKey | QPXLMOFDUMQKQW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|