About triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate
triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate (PubChem CID 86039083) has the molecular formula C17H38O3Si2
and a molecular weight of 346.66 g/mol. Its IUPAC name is triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate.
Molecular Properties
| Compound Name | triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate |
| PubChem CID | 86039083 |
| Molecular Formula | C17H38O3Si2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate |
| SMILES | CCO[Si](C)(C)C(C)CC(C)(C)C(=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H38O3Si2/c1-10-19-21(8,9)15(5)14-17(6,7)16(18)20-22(11-2,12-3)13-4/h15H,10-14H2,1-9H3 |
| InChIKey | TUUSETJPICZICF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate?
The IUPAC name of triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate (CID 86039083) is triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate.
What is the SMILES notation for triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate?
The canonical SMILES for triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate is CCO[Si](C)(C)C(C)CC(C)(C)C(=O)O[Si](CC)(CC)CC.
What is the InChIKey of triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate?
The InChIKey is TUUSETJPICZICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38O3Si2/c1-10-19-21(8,9)15(5)14-17(6,7)16(18)20-22(11-2,12-3)13-4/h15H,10-14H2,1-9H3.
What are the key properties of triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate?
triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate has a molecular weight of 346.66 g/mol, XLogP of 5.58, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsilyl 4-[ethoxy(dimethyl)silyl]-2,2-dimethylpentanoate is sourced from PubChem (CID 86039083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).