About 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine
2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine (PubChem CID 86040760) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine.
Molecular Properties
| Compound Name | 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine |
| PubChem CID | 86040760 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine |
| SMILES | CCCC#Cc1ccccc1C1OCC=CCO1 |
| InChI | InChI=1S/C16H18O2/c1-2-3-4-9-14-10-5-6-11-15(14)16-17-12-7-8-13-18-16/h5-8,10-11,16H,2-3,12-13H2,1H3 |
| InChIKey | HOOTVQFXMNZHTL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine?
The IUPAC name of 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine (CID 86040760) is 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine.
What is the SMILES notation for 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine?
The canonical SMILES for 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine is CCCC#Cc1ccccc1C1OCC=CCO1.
What is the InChIKey of 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine?
The InChIKey is HOOTVQFXMNZHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-2-3-4-9-14-10-5-6-11-15(14)16-17-12-7-8-13-18-16/h5-8,10-11,16H,2-3,12-13H2,1H3.
What are the key properties of 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine?
2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine has a molecular weight of 242.32 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pent-1-ynylphenyl)-4,7-dihydro-1,3-dioxepine is sourced from PubChem (CID 86040760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).