About guanidine;5-nitro-1H-1,2,4-triazole
guanidine;5-nitro-1H-1,2,4-triazole (PubChem CID 86040863) has the molecular formula C3H7N7O2
and a molecular weight of 173.14 g/mol. Its IUPAC name is guanidine;5-nitro-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | guanidine;5-nitro-1H-1,2,4-triazole |
| PubChem CID | 86040863 |
| Molecular Formula | C3H7N7O2 |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | guanidine;5-nitro-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn[nH]1.[H]N=C(N)N |
| InChI | InChI=1S/C2H2N4O2.CH5N3/c7-6(8)2-3-1-4-5-2;2-1(3)4/h1H,(H,3,4,5);(H5,2,3,4) |
| InChIKey | ZOLCQASBYNWEPQ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze guanidine;5-nitro-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;5-nitro-1H-1,2,4-triazole?
The IUPAC name of guanidine;5-nitro-1H-1,2,4-triazole (CID 86040863) is guanidine;5-nitro-1H-1,2,4-triazole.
What is the SMILES notation for guanidine;5-nitro-1H-1,2,4-triazole?
The canonical SMILES for guanidine;5-nitro-1H-1,2,4-triazole is O=[N+]([O-])c1ncn[nH]1.[H]N=C(N)N.
What is the InChIKey of guanidine;5-nitro-1H-1,2,4-triazole?
The InChIKey is ZOLCQASBYNWEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2N4O2.CH5N3/c7-6(8)2-3-1-4-5-2;2-1(3)4/h1H,(H,3,4,5);(H5,2,3,4).
What are the key properties of guanidine;5-nitro-1H-1,2,4-triazole?
guanidine;5-nitro-1H-1,2,4-triazole has a molecular weight of 173.14 g/mol, XLogP of -1.45, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;5-nitro-1H-1,2,4-triazole is sourced from PubChem (CID 86040863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).