About dec-1-enyl 2-methylpropanoate
dec-1-enyl 2-methylpropanoate (PubChem CID 86042241) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is dec-1-enyl 2-methylpropanoate.
Molecular Properties
| Compound Name | dec-1-enyl 2-methylpropanoate |
| PubChem CID | 86042241 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | dec-1-enyl 2-methylpropanoate |
| SMILES | CCCCCCCCC=COC(=O)C(C)C |
| InChI | InChI=1S/C14H26O2/c1-4-5-6-7-8-9-10-11-12-16-14(15)13(2)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | DTNFIECGICCOMX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dec-1-enyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-enyl 2-methylpropanoate?
The IUPAC name of dec-1-enyl 2-methylpropanoate (CID 86042241) is dec-1-enyl 2-methylpropanoate.
What is the SMILES notation for dec-1-enyl 2-methylpropanoate?
The canonical SMILES for dec-1-enyl 2-methylpropanoate is CCCCCCCCC=COC(=O)C(C)C.
What is the InChIKey of dec-1-enyl 2-methylpropanoate?
The InChIKey is DTNFIECGICCOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-4-5-6-7-8-9-10-11-12-16-14(15)13(2)3/h11-13H,4-10H2,1-3H3.
What are the key properties of dec-1-enyl 2-methylpropanoate?
dec-1-enyl 2-methylpropanoate has a molecular weight of 226.36 g/mol, XLogP of 4.45, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-enyl 2-methylpropanoate is sourced from PubChem (CID 86042241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).