About cyclobutadienylbenzene
cyclobutadienylbenzene (PubChem CID 86042442) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is cyclobutadienylbenzene.
Molecular Properties
| Compound Name | cyclobutadienylbenzene |
| PubChem CID | 86042442 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | cyclobutadienylbenzene |
| SMILES | C1=CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C10H8/c1-2-5-9(6-3-1)10-7-4-8-10/h1-8H |
| InChIKey | SWSMPDUAYCFIST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclobutadienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutadienylbenzene?
The IUPAC name of cyclobutadienylbenzene (CID 86042442) is cyclobutadienylbenzene.
What is the SMILES notation for cyclobutadienylbenzene?
The canonical SMILES for cyclobutadienylbenzene is C1=CC(c2ccccc2)=C1.
What is the InChIKey of cyclobutadienylbenzene?
The InChIKey is SWSMPDUAYCFIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-2-5-9(6-3-1)10-7-4-8-10/h1-8H.
What are the key properties of cyclobutadienylbenzene?
cyclobutadienylbenzene has a molecular weight of 128.17 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutadienylbenzene is sourced from PubChem (CID 86042442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).