About ethyl 3-oxononadecanoate
ethyl 3-oxononadecanoate (PubChem CID 86044196) has the molecular formula C21H40O3
and a molecular weight of 340.55 g/mol. Its IUPAC name is ethyl 3-oxononadecanoate.
Molecular Properties
| Compound Name | ethyl 3-oxononadecanoate |
| PubChem CID | 86044196 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | ethyl 3-oxononadecanoate |
| SMILES | CCCCCCCCCCCCCCCCC(=O)CC(=O)OCC |
| InChI | InChI=1S/C21H40O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)19-21(23)24-4-2/h3-19H2,1-2H3 |
| InChIKey | ORBQEFJMHGVQEP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxononadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxononadecanoate?
The IUPAC name of ethyl 3-oxononadecanoate (CID 86044196) is ethyl 3-oxononadecanoate.
What is the SMILES notation for ethyl 3-oxononadecanoate?
The canonical SMILES for ethyl 3-oxononadecanoate is CCCCCCCCCCCCCCCCC(=O)CC(=O)OCC.
What is the InChIKey of ethyl 3-oxononadecanoate?
The InChIKey is ORBQEFJMHGVQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)19-21(23)24-4-2/h3-19H2,1-2H3.
What are the key properties of ethyl 3-oxononadecanoate?
ethyl 3-oxononadecanoate has a molecular weight of 340.55 g/mol, XLogP of 6.38, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxononadecanoate is sourced from PubChem (CID 86044196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).