About 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde
5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde (PubChem CID 86044311) has the molecular formula C5H5NO3
and a molecular weight of 127.10 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde |
| PubChem CID | 86044311 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1cc(CO)on1 |
| InChI | InChI=1S/C5H5NO3/c7-2-4-1-5(3-8)9-6-4/h1-2,8H,3H2 |
| InChIKey | ATBNGULVUAYJHH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde?
The IUPAC name of 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde (CID 86044311) is 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde.
What is the SMILES notation for 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde?
The canonical SMILES for 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde is O=Cc1cc(CO)on1.
What is the InChIKey of 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde?
The InChIKey is ATBNGULVUAYJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3/c7-2-4-1-5(3-8)9-6-4/h1-2,8H,3H2.
What are the key properties of 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde?
5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde has a molecular weight of 127.10 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-1,2-oxazole-3-carbaldehyde is sourced from PubChem (CID 86044311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).