C9H14N6 — CID 86046952
9-ethyl-6-N,6-N-dimethylpurine-2,6-diamine (PubChem CID 86046952) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 9-ethyl-6-N,6-N-dimethylpurine-2,6-diamine.
| Compound Name | 9-ethyl-6-N,6-N-dimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 86046952 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 9-ethyl-6-N,6-N-dimethylpurine-2,6-diamine |
| SMILES | CCn1cnc2c(N(C)C)nc(N)nc21 |
| InChI | InChI=1S/C9H14N6/c1-4-15-5-11-6-7(14(2)3)12-9(10)13-8(6)15/h5H,4H2,1-3H3,(H2,10,12,13) |
| InChIKey | LGULIWBPMDGAGW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |