About (2,3-dioxo-1H-indol-5-yl) thiocyanate
(2,3-dioxo-1H-indol-5-yl) thiocyanate (PubChem CID 86048657) has the molecular formula C9H4N2O2S
and a molecular weight of 204.21 g/mol. Its IUPAC name is (2,3-dioxo-1H-indol-5-yl) thiocyanate.
Molecular Properties
| Compound Name | (2,3-dioxo-1H-indol-5-yl) thiocyanate |
| PubChem CID | 86048657 |
| Molecular Formula | C9H4N2O2S |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | (2,3-dioxo-1H-indol-5-yl) thiocyanate |
| SMILES | N#CSc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C9H4N2O2S/c10-4-14-5-1-2-7-6(3-5)8(12)9(13)11-7/h1-3H,(H,11,12,13) |
| InChIKey | FXJARYYPEZZFQW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dioxo-1H-indol-5-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dioxo-1H-indol-5-yl) thiocyanate?
The IUPAC name of (2,3-dioxo-1H-indol-5-yl) thiocyanate (CID 86048657) is (2,3-dioxo-1H-indol-5-yl) thiocyanate.
What is the SMILES notation for (2,3-dioxo-1H-indol-5-yl) thiocyanate?
The canonical SMILES for (2,3-dioxo-1H-indol-5-yl) thiocyanate is N#CSc1ccc2c(c1)C(=O)C(=O)N2.
What is the InChIKey of (2,3-dioxo-1H-indol-5-yl) thiocyanate?
The InChIKey is FXJARYYPEZZFQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O2S/c10-4-14-5-1-2-7-6(3-5)8(12)9(13)11-7/h1-3H,(H,11,12,13).
What are the key properties of (2,3-dioxo-1H-indol-5-yl) thiocyanate?
(2,3-dioxo-1H-indol-5-yl) thiocyanate has a molecular weight of 204.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dioxo-1H-indol-5-yl) thiocyanate is sourced from PubChem (CID 86048657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).