About 1-methylimidazo[4,5-f]quinoxalin-2-amine
1-methylimidazo[4,5-f]quinoxalin-2-amine (PubChem CID 86048725) has the molecular formula C10H9N5
and a molecular weight of 199.22 g/mol. Its IUPAC name is 1-methylimidazo[4,5-f]quinoxalin-2-amine.
Molecular Properties
| Compound Name | 1-methylimidazo[4,5-f]quinoxalin-2-amine |
| PubChem CID | 86048725 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-methylimidazo[4,5-f]quinoxalin-2-amine |
| SMILES | Cn1c(N)nc2ccc3nccnc3c21 |
| InChI | InChI=1S/C10H9N5/c1-15-9-7(14-10(15)11)3-2-6-8(9)13-5-4-12-6/h2-5H,1H3,(H2,11,14) |
| InChIKey | OYQDGGULHAGLKT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methylimidazo[4,5-f]quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazo[4,5-f]quinoxalin-2-amine?
The IUPAC name of 1-methylimidazo[4,5-f]quinoxalin-2-amine (CID 86048725) is 1-methylimidazo[4,5-f]quinoxalin-2-amine.
What is the SMILES notation for 1-methylimidazo[4,5-f]quinoxalin-2-amine?
The canonical SMILES for 1-methylimidazo[4,5-f]quinoxalin-2-amine is Cn1c(N)nc2ccc3nccnc3c21.
What is the InChIKey of 1-methylimidazo[4,5-f]quinoxalin-2-amine?
The InChIKey is OYQDGGULHAGLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5/c1-15-9-7(14-10(15)11)3-2-6-8(9)13-5-4-12-6/h2-5H,1H3,(H2,11,14).
What are the key properties of 1-methylimidazo[4,5-f]quinoxalin-2-amine?
1-methylimidazo[4,5-f]quinoxalin-2-amine has a molecular weight of 199.22 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazo[4,5-f]quinoxalin-2-amine is sourced from PubChem (CID 86048725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).