C13H13FO3 — CID 86049786
5-fluoro-3,6-dimethoxy-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 86049786) has the molecular formula C13H13FO3 and a molecular weight of 236.24 g/mol. Its IUPAC name is 5-fluoro-3,6-dimethoxy-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 5-fluoro-3,6-dimethoxy-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 86049786 |
| Molecular Formula | C13H13FO3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-fluoro-3,6-dimethoxy-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | COc1cc(F)c(OC)c2c1C1(C)C=CC2O1 |
| InChI | InChI=1S/C13H13FO3/c1-13-5-4-8(17-13)10-11(13)9(15-2)6-7(14)12(10)16-3/h4-6,8H,1-3H3 |
| InChIKey | XHLMBTIIIRTHAE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|