About 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane
3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane (PubChem CID 86050095) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane |
| PubChem CID | 86050095 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane |
| SMILES | CC1(C)COC2(CCNCC2)OO1 |
| InChI | InChI=1S/C9H17NO3/c1-8(2)7-11-9(13-12-8)3-5-10-6-4-9/h10H,3-7H2,1-2H3 |
| InChIKey | TYXXSBZOHBMFDK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane?
The IUPAC name of 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane (CID 86050095) is 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane.
What is the SMILES notation for 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane?
The canonical SMILES for 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane is CC1(C)COC2(CCNCC2)OO1.
What is the InChIKey of 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane?
The InChIKey is TYXXSBZOHBMFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-8(2)7-11-9(13-12-8)3-5-10-6-4-9/h10H,3-7H2,1-2H3.
What are the key properties of 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane?
3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane has a molecular weight of 187.24 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecane is sourced from PubChem (CID 86050095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).