About 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid
2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid (PubChem CID 860505) has the molecular formula C16H10FN3O3S
and a molecular weight of 343.34 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
| PubChem CID | 860505 |
| Molecular Formula | C16H10FN3O3S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1nnc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C16H10FN3O3S/c17-12-8-4-3-7-11(12)14-19-20-16(24-14)18-13(21)9-5-1-2-6-10(9)15(22)23/h1-8H,(H,22,23)(H,18,20,21) |
| InChIKey | NXNUHZGJMWIVAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid?
The IUPAC name of 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid (CID 860505) is 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid.
What is the SMILES notation for 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid?
The canonical SMILES for 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid is O=C(O)c1ccccc1C(=O)Nc1nnc(-c2ccccc2F)s1.
What is the InChIKey of 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid?
The InChIKey is NXNUHZGJMWIVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN3O3S/c17-12-8-4-3-7-11(12)14-19-20-16(24-14)18-13(21)9-5-1-2-6-10(9)15(22)23/h1-8H,(H,22,23)(H,18,20,21).
What are the key properties of 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid?
2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid has a molecular weight of 343.34 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]carbamoyl]benzoic acid is sourced from PubChem (CID 860505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).