C12H7NO3S — CID 86050599
7-amino-8-sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 86050599) has the molecular formula C12H7NO3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 7-amino-8-sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 7-amino-8-sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 86050599 |
| Molecular Formula | C12H7NO3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 7-amino-8-sulfanyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | Nc1cc2c3c(cccc3c1S)C(=O)OC2=O |
| InChI | InChI=1S/C12H7NO3S/c13-8-4-7-9-5(10(8)17)2-1-3-6(9)11(14)16-12(7)15/h1-4,17H,13H2 |
| InChIKey | IAEHJWZXRWDRLV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|