About 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane
2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane (PubChem CID 86051332) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane |
| PubChem CID | 86051332 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane |
| SMILES | CC1(C)OC12OCCCO2 |
| InChI | InChI=1S/C7H12O3/c1-6(2)7(10-6)8-4-3-5-9-7/h3-5H2,1-2H3 |
| InChIKey | SZYZZCDWAPQKPI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane?
The IUPAC name of 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane (CID 86051332) is 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane.
What is the SMILES notation for 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane?
The canonical SMILES for 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane is CC1(C)OC12OCCCO2.
What is the InChIKey of 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane?
The InChIKey is SZYZZCDWAPQKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-6(2)7(10-6)8-4-3-5-9-7/h3-5H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane?
2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane has a molecular weight of 144.17 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,4,8-trioxaspiro[2.5]octane is sourced from PubChem (CID 86051332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).