C13H15NO4 — CID 86052067
3-[ethyl(prop-2-enoxy)carbamoyl]benzoic acid (PubChem CID 86052067) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-[ethyl(prop-2-enoxy)carbamoyl]benzoic acid.
| Compound Name | 3-[ethyl(prop-2-enoxy)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 86052067 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[ethyl(prop-2-enoxy)carbamoyl]benzoic acid |
| SMILES | C=CCON(CC)C(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H15NO4/c1-3-8-18-14(4-2)12(15)10-6-5-7-11(9-10)13(16)17/h3,5-7,9H,1,4,8H2,2H3,(H,16,17) |
| InChIKey | PBBFVQNHFUALMI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|