About 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one
5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one (PubChem CID 86052396) has the molecular formula C16H20O3S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one |
| PubChem CID | 86052396 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one |
| SMILES | CC1C(=O)C2(C)CCC1C(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C16H20O3S/c1-11-13-8-9-16(2,15(11)17)10-14(13)20(18,19)12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3 |
| InChIKey | XJBPNTXJVDYEII-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one?
The IUPAC name of 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one (CID 86052396) is 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one.
What is the SMILES notation for 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one?
The canonical SMILES for 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one is CC1C(=O)C2(C)CCC1C(S(=O)(=O)c1ccccc1)C2.
What is the InChIKey of 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one?
The InChIKey is XJBPNTXJVDYEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3S/c1-11-13-8-9-16(2,15(11)17)10-14(13)20(18,19)12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3.
What are the key properties of 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one?
5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one has a molecular weight of 292.40 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-1,3-dimethylbicyclo[2.2.2]octan-2-one is sourced from PubChem (CID 86052396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).