About 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline
2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline (PubChem CID 86052649) has the molecular formula C17H17ClN2O2
and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline |
| PubChem CID | 86052649 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline |
| SMILES | COC1(OC)N=C(c2ccc(Cl)cc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C17H17ClN2O2/c1-20-15-7-5-4-6-14(15)17(21-2,22-3)19-16(20)12-8-10-13(18)11-9-12/h4-11H,1-3H3 |
| InChIKey | ZKUCSIDVDDXPMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline?
The IUPAC name of 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline (CID 86052649) is 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline.
What is the SMILES notation for 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline?
The canonical SMILES for 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline is COC1(OC)N=C(c2ccc(Cl)cc2)N(C)c2ccccc21.
What is the InChIKey of 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline?
The InChIKey is ZKUCSIDVDDXPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O2/c1-20-15-7-5-4-6-14(15)17(21-2,22-3)19-16(20)12-8-10-13(18)11-9-12/h4-11H,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline?
2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline has a molecular weight of 316.79 g/mol, XLogP of 3.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,4-dimethoxy-1-methylquinazoline is sourced from PubChem (CID 86052649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).