C11H21F2N5O2 — CID 86054607
15,15-difluoro-1,4,7,10,13-pentazacyclohexadecane-14,16-dione (PubChem CID 86054607) has the molecular formula C11H21F2N5O2 and a molecular weight of 293.32 g/mol. Its IUPAC name is 15,15-difluoro-1,4,7,10,13-pentazacyclohexadecane-14,16-dione.
| Compound Name | 15,15-difluoro-1,4,7,10,13-pentazacyclohexadecane-14,16-dione |
|---|---|
| PubChem CID | 86054607 |
| Molecular Formula | C11H21F2N5O2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 15,15-difluoro-1,4,7,10,13-pentazacyclohexadecane-14,16-dione |
| SMILES | O=C1NCCNCCNCCNCCNC(=O)C1(F)F |
| InChI | InChI=1S/C11H21F2N5O2/c12-11(13)9(19)17-7-5-15-3-1-14-2-4-16-6-8-18-10(11)20/h14-16H,1-8H2,(H,17,19)(H,18,20) |
| InChIKey | GMUZLSVZNQKASY-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|