C15H23N — CID 86055539
3-pentan-3-yl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 86055539) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3-pentan-3-yl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-pentan-3-yl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 86055539 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-pentan-3-yl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | CCC(CC)N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C15H23N/c1-3-15(4-2)16-11-9-13-7-5-6-8-14(13)10-12-16/h5-8,15H,3-4,9-12H2,1-2H3 |
| InChIKey | QAMBXZDIGVTGCZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |