C20H17NO2 — CID 86055746
3,3-dimethyl-1-phenyl-3a,9a-dihydrobenzo[f]isoindole-4,9-dione (PubChem CID 86055746) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenyl-3a,9a-dihydrobenzo[f]isoindole-4,9-dione.
| Compound Name | 3,3-dimethyl-1-phenyl-3a,9a-dihydrobenzo[f]isoindole-4,9-dione |
|---|---|
| PubChem CID | 86055746 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3,3-dimethyl-1-phenyl-3a,9a-dihydrobenzo[f]isoindole-4,9-dione |
| SMILES | CC1(C)N=C(c2ccccc2)C2C(=O)c3ccccc3C(=O)C21 |
| InChI | InChI=1S/C20H17NO2/c1-20(2)16-15(17(21-20)12-8-4-3-5-9-12)18(22)13-10-6-7-11-14(13)19(16)23/h3-11,15-16H,1-2H3 |
| InChIKey | YMQPWHJWNQJSDG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|