About 4-purin-9-yloctan-2-one
4-purin-9-yloctan-2-one (PubChem CID 86056354) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-purin-9-yloctan-2-one.
Molecular Properties
| Compound Name | 4-purin-9-yloctan-2-one |
| PubChem CID | 86056354 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-purin-9-yloctan-2-one |
| SMILES | CCCCC(CC(C)=O)n1cnc2cncnc21 |
| InChI | InChI=1S/C13H18N4O/c1-3-4-5-11(6-10(2)18)17-9-16-12-7-14-8-15-13(12)17/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | YVUDZIVUGRDDGS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-purin-9-yloctan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-purin-9-yloctan-2-one?
The IUPAC name of 4-purin-9-yloctan-2-one (CID 86056354) is 4-purin-9-yloctan-2-one.
What is the SMILES notation for 4-purin-9-yloctan-2-one?
The canonical SMILES for 4-purin-9-yloctan-2-one is CCCCC(CC(C)=O)n1cnc2cncnc21.
What is the InChIKey of 4-purin-9-yloctan-2-one?
The InChIKey is YVUDZIVUGRDDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-3-4-5-11(6-10(2)18)17-9-16-12-7-14-8-15-13(12)17/h7-9,11H,3-6H2,1-2H3.
What are the key properties of 4-purin-9-yloctan-2-one?
4-purin-9-yloctan-2-one has a molecular weight of 246.31 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-purin-9-yloctan-2-one is sourced from PubChem (CID 86056354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).