About 10-hydroxy-10-methylheptadeca-1,16-dien-8-one
10-hydroxy-10-methylheptadeca-1,16-dien-8-one (PubChem CID 86056751) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 10-hydroxy-10-methylheptadeca-1,16-dien-8-one.
Molecular Properties
| Compound Name | 10-hydroxy-10-methylheptadeca-1,16-dien-8-one |
| PubChem CID | 86056751 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 10-hydroxy-10-methylheptadeca-1,16-dien-8-one |
| SMILES | C=CCCCCCC(=O)CC(C)(O)CCCCCC=C |
| InChI | InChI=1S/C18H32O2/c1-4-6-8-10-12-14-17(19)16-18(3,20)15-13-11-9-7-5-2/h4-5,20H,1-2,6-16H2,3H3 |
| InChIKey | FCPIQQQLOLBBAW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-hydroxy-10-methylheptadeca-1,16-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-hydroxy-10-methylheptadeca-1,16-dien-8-one?
The IUPAC name of 10-hydroxy-10-methylheptadeca-1,16-dien-8-one (CID 86056751) is 10-hydroxy-10-methylheptadeca-1,16-dien-8-one.
What is the SMILES notation for 10-hydroxy-10-methylheptadeca-1,16-dien-8-one?
The canonical SMILES for 10-hydroxy-10-methylheptadeca-1,16-dien-8-one is C=CCCCCCC(=O)CC(C)(O)CCCCCC=C.
What is the InChIKey of 10-hydroxy-10-methylheptadeca-1,16-dien-8-one?
The InChIKey is FCPIQQQLOLBBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2/c1-4-6-8-10-12-14-17(19)16-18(3,20)15-13-11-9-7-5-2/h4-5,20H,1-2,6-16H2,3H3.
What are the key properties of 10-hydroxy-10-methylheptadeca-1,16-dien-8-one?
10-hydroxy-10-methylheptadeca-1,16-dien-8-one has a molecular weight of 280.45 g/mol, XLogP of 4.97, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxy-10-methylheptadeca-1,16-dien-8-one is sourced from PubChem (CID 86056751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).