About 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene
2-bromo-5-iodo-1,3-di(propan-2-yl)benzene (PubChem CID 86057486) has the molecular formula C12H16BrI
and a molecular weight of 367.07 g/mol. Its IUPAC name is 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene |
| PubChem CID | 86057486 |
| Molecular Formula | C12H16BrI |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(I)cc(C(C)C)c1Br |
| InChI | InChI=1S/C12H16BrI/c1-7(2)10-5-9(14)6-11(8(3)4)12(10)13/h5-8H,1-4H3 |
| InChIKey | IVELKHGZTBWGNN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene (CID 86057486) is 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene is CC(C)c1cc(I)cc(C(C)C)c1Br.
What is the InChIKey of 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene?
The InChIKey is IVELKHGZTBWGNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrI/c1-7(2)10-5-9(14)6-11(8(3)4)12(10)13/h5-8H,1-4H3.
What are the key properties of 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene?
2-bromo-5-iodo-1,3-di(propan-2-yl)benzene has a molecular weight of 367.07 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-iodo-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 86057486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).