C14H17NO2 — CID 86058522
5-but-3-enyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 86058522) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-but-3-enyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-but-3-enyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 86058522 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 5-but-3-enyl-3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | C=CCCC1CC(c2ccc(OC)cc2)=NO1 |
| InChI | InChI=1S/C14H17NO2/c1-3-4-5-13-10-14(15-17-13)11-6-8-12(16-2)9-7-11/h3,6-9,13H,1,4-5,10H2,2H3 |
| InChIKey | VAWWNNMVOPJPKH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|