C15H25FO — CID 86058631
2-fluoro-3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 86058631) has the molecular formula C15H25FO and a molecular weight of 240.36 g/mol. Its IUPAC name is 2-fluoro-3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | 2-fluoro-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 86058631 |
| Molecular Formula | C15H25FO |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-fluoro-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=C(F)CO |
| InChI | InChI=1S/C15H25FO/c1-12(2)7-5-8-13(3)9-6-10-14(4)15(16)11-17/h7,9,17H,5-6,8,10-11H2,1-4H3 |
| InChIKey | HRBGAHVKLCJDPZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|