About (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate
(2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 86058728) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate.
Molecular Properties
| Compound Name | (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate |
| PubChem CID | 86058728 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | CN1CCN(CC(=O)ON2CCCC2=O)CC1 |
| InChI | InChI=1S/C11H19N3O3/c1-12-5-7-13(8-6-12)9-11(16)17-14-4-2-3-10(14)15/h2-9H2,1H3 |
| InChIKey | CWMWNSHWGQODOB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate?
The IUPAC name of (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate (CID 86058728) is (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate.
What is the SMILES notation for (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate?
The canonical SMILES for (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate is CN1CCN(CC(=O)ON2CCCC2=O)CC1.
What is the InChIKey of (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate?
The InChIKey is CWMWNSHWGQODOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-12-5-7-13(8-6-12)9-11(16)17-14-4-2-3-10(14)15/h2-9H2,1H3.
What are the key properties of (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate?
(2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate has a molecular weight of 241.29 g/mol, XLogP of -0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopyrrolidin-1-yl) 2-(4-methylpiperazin-1-yl)acetate is sourced from PubChem (CID 86058728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).