C11H14O2 — CID 86059189
4-hydroxy-1,5,5-trimethyl-1,4-dihydropentalen-2-one (PubChem CID 86059189) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-hydroxy-1,5,5-trimethyl-1,4-dihydropentalen-2-one.
| Compound Name | 4-hydroxy-1,5,5-trimethyl-1,4-dihydropentalen-2-one |
|---|---|
| PubChem CID | 86059189 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-hydroxy-1,5,5-trimethyl-1,4-dihydropentalen-2-one |
| SMILES | CC1C(=O)C=C2C1=CC(C)(C)C2O |
| InChI | InChI=1S/C11H14O2/c1-6-8-5-11(2,3)10(13)7(8)4-9(6)12/h4-6,10,13H,1-3H3 |
| InChIKey | YXVOETAZQGQTCW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |